C10H11BrClN5O — CID 19295823
N-[3-(4-bromopyrazol-1-yl)propyl]-4-chloro-1H-pyrazole-5-carboxamide (PubChem CID 19295823) has the molecular formula C10H11BrClN5O and a molecular weight of 332.59 g/mol. Its IUPAC name is N-[3-(4-bromopyrazol-1-yl)propyl]-4-chloro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-(4-bromopyrazol-1-yl)propyl]-4-chloro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19295823 |
| Molecular Formula | C10H11BrClN5O |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | N-[3-(4-bromopyrazol-1-yl)propyl]-4-chloro-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCCn1cc(Br)cn1)c1[nH]ncc1Cl |
| InChI | InChI=1S/C10H11BrClN5O/c11-7-4-15-17(6-7)3-1-2-13-10(18)9-8(12)5-14-16-9/h4-6H,1-3H2,(H,13,18)(H,14,16) |
| InChIKey | XDLXNNLQTMJBTJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|