C9H9ClN6O3 — CID 19574664
4-chloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 19574664) has the molecular formula C9H9ClN6O3 and a molecular weight of 284.66 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19574664 |
| Molecular Formula | C9H9ClN6O3 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-chloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCCn1cc([N+](=O)[O-])cn1)c1[nH]ncc1Cl |
| InChI | InChI=1S/C9H9ClN6O3/c10-7-4-12-14-8(7)9(17)11-1-2-15-5-6(3-13-15)16(18)19/h3-5H,1-2H2,(H,11,17)(H,12,14) |
| InChIKey | BWESIZIRFHZVBJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|