C16H17Cl2N5O5S — CID 5243711
2,4-dichloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 5243711) has the molecular formula C16H17Cl2N5O5S and a molecular weight of 462.32 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5243711 |
| Molecular Formula | C16H17Cl2N5O5S |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 2,4-dichloro-N-[2-(4-nitropyrazol-1-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCCn1cc([N+](=O)[O-])cn1)c1cc(S(=O)(=O)N2CCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N5O5S/c17-13-8-14(18)15(29(27,28)22-4-1-2-5-22)7-12(13)16(24)19-3-6-21-10-11(9-20-21)23(25)26/h7-10H,1-6H2,(H,19,24) |
| InChIKey | FKLGFILYYLWLPP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|