C19H22Cl4N4O3S — CID 19332140
2,4-dichloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19332140) has the molecular formula C19H22Cl4N4O3S and a molecular weight of 528.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19332140 |
| Molecular Formula | C19H22Cl4N4O3S |
| Molecular Weight | 528.29 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 2,4-dichloro-N-[3-(4,5-dichloro-3-methylpyrazol-1-yl)propyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1nn(CCCNC(=O)c2cc(S(=O)(=O)N3CCCCC3)c(Cl)cc2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C19H22Cl4N4O3S/c1-12-17(22)18(23)27(25-12)9-5-6-24-19(28)13-10-16(15(21)11-14(13)20)31(29,30)26-7-3-2-4-8-26/h10-11H,2-9H2,1H3,(H,24,28) |
| InChIKey | ZWNNQLPQVPARAD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|