C18H22Cl2N4O3S — CID 19331140
2,4-dichloro-N-[(1-ethylpyrazol-3-yl)methyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19331140) has the molecular formula C18H22Cl2N4O3S and a molecular weight of 445.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1-ethylpyrazol-3-yl)methyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[(1-ethylpyrazol-3-yl)methyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19331140 |
| Molecular Formula | C18H22Cl2N4O3S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2,4-dichloro-N-[(1-ethylpyrazol-3-yl)methyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCn1ccc(CNC(=O)c2cc(S(=O)(=O)N3CCCCC3)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H22Cl2N4O3S/c1-2-23-9-6-13(22-23)12-21-18(25)14-10-17(16(20)11-15(14)19)28(26,27)24-7-4-3-5-8-24/h6,9-11H,2-5,7-8,12H2,1H3,(H,21,25) |
| InChIKey | FUTVWUCVLNMBPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |