C22H17Cl2F5N4O3S — CID 19286881
2,4-dichloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19286881) has the molecular formula C22H17Cl2F5N4O3S and a molecular weight of 583.37 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19286881 |
| Molecular Formula | C22H17Cl2F5N4O3S |
| Molecular Weight | 583.37 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 2,4-dichloro-N-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2F5N4O3S/c23-13-9-14(24)15(37(35,36)33-5-2-1-3-6-33)8-11(13)22(34)30-16-4-7-32(31-16)10-12-17(25)19(27)21(29)20(28)18(12)26/h4,7-9H,1-3,5-6,10H2,(H,30,31,34) |
| InChIKey | OAMZJAGCFGDYAH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|