C22H18Cl2F4N4O3S — CID 19286580
2,4-dichloro-5-piperidin-1-ylsulfonyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide (PubChem CID 19286580) has the molecular formula C22H18Cl2F4N4O3S and a molecular weight of 565.38 g/mol. Its IUPAC name is 2,4-dichloro-5-piperidin-1-ylsulfonyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide.
| Compound Name | 2,4-dichloro-5-piperidin-1-ylsulfonyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 19286580 |
| Molecular Formula | C22H18Cl2F4N4O3S |
| Molecular Weight | 565.38 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | 2,4-dichloro-5-piperidin-1-ylsulfonyl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H18Cl2F4N4O3S/c23-14-9-15(24)18(36(34,35)32-5-2-1-3-6-32)8-12(14)22(33)29-19-4-7-31(30-19)11-13-20(27)16(25)10-17(26)21(13)28/h4,7-10H,1-3,5-6,11H2,(H,29,30,33) |
| InChIKey | HJDUASPWJMYIST-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|