C22H22Cl2N4O3S — CID 19397502
N-(1-benzylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19397502) has the molecular formula C22H22Cl2N4O3S and a molecular weight of 493.42 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19397502 |
| Molecular Formula | C22H22Cl2N4O3S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cnn(Cc2ccccc2)c1)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H22Cl2N4O3S/c23-19-12-20(24)21(32(30,31)28-9-5-2-6-10-28)11-18(19)22(29)26-17-13-25-27(15-17)14-16-7-3-1-4-8-16/h1,3-4,7-8,11-13,15H,2,5-6,9-10,14H2,(H,26,29) |
| InChIKey | CFXAQXJGFIXGOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |