C24H26Cl2N4O3S — CID 19335854
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19335854) has the molecular formula C24H26Cl2N4O3S and a molecular weight of 521.47 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19335854 |
| Molecular Formula | C24H26Cl2N4O3S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,4-dichloro-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C24H26Cl2N4O3S/c1-16-23(17(2)30(28-16)15-18-9-5-3-6-10-18)27-24(31)19-13-22(21(26)14-20(19)25)34(32,33)29-11-7-4-8-12-29/h3,5-6,9-10,13-14H,4,7-8,11-12,15H2,1-2H3,(H,27,31) |
| InChIKey | JZZVVUUBJQERHH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |