C17H17F4N3O — CID 19286658
N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide (PubChem CID 19286658) has the molecular formula C17H17F4N3O and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 19286658 |
| Molecular Formula | C17H17F4N3O |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1)C1CCCCC1 |
| InChI | InChI=1S/C17H17F4N3O/c18-12-8-13(19)16(21)11(15(12)20)9-24-7-6-14(23-24)22-17(25)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H,22,23,25) |
| InChIKey | SDJCGOIUBFHDEN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|