C12H10F3N3O — CID 68643541
N-[1-[(2,3,6-trifluorophenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 68643541) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is N-[1-[(2,3,6-trifluorophenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | N-[1-[(2,3,6-trifluorophenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 68643541 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-[1-[(2,3,6-trifluorophenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccn(Cc2c(F)ccc(F)c2F)n1 |
| InChI | InChI=1S/C12H10F3N3O/c1-7(19)16-11-4-5-18(17-11)6-8-9(13)2-3-10(14)12(8)15/h2-5H,6H2,1H3,(H,16,17,19) |
| InChIKey | ALPIOQLYQATOIZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|