C16H16F4N4OS — CID 19395323
1-(oxolan-2-ylmethyl)-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19395323) has the molecular formula C16H16F4N4OS and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19395323 |
| Molecular Formula | C16H16F4N4OS |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Fc1cc(F)c(F)c(Cn2ccc(NC(=S)NCC3CCCO3)n2)c1F |
| InChI | InChI=1S/C16H16F4N4OS/c17-11-6-12(18)15(20)10(14(11)19)8-24-4-3-13(23-24)22-16(26)21-7-9-2-1-5-25-9/h3-4,6,9H,1-2,5,7-8H2,(H2,21,22,23,26) |
| InChIKey | RWEYXZPLSHTVLQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|