C20H22Cl3F3N4O3S — CID 19326096
2,4-dichloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 19326096) has the molecular formula C20H22Cl3F3N4O3S and a molecular weight of 561.84 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 19326096 |
| Molecular Formula | C20H22Cl3F3N4O3S |
| Molecular Weight | 561.84 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 2,4-dichloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl3F3N4O3S/c1-12-17(23)18(20(24,25)26)28-30(12)9-5-6-27-19(31)13-10-16(15(22)11-14(13)21)34(32,33)29-7-3-2-4-8-29/h10-11H,2-9H2,1H3,(H,27,31) |
| InChIKey | PNLYPFJQTYITNY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|