C17H14Cl2F3N3OS — CID 19326176
3-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-benzothiophene-2-carboxamide (PubChem CID 19326176) has the molecular formula C17H14Cl2F3N3OS and a molecular weight of 436.29 g/mol. Its IUPAC name is 3-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 19326176 |
| Molecular Formula | C17H14Cl2F3N3OS |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 3-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H14Cl2F3N3OS/c1-9-12(18)15(17(20,21)22)24-25(9)8-4-7-23-16(26)14-13(19)10-5-2-3-6-11(10)27-14/h2-3,5-6H,4,7-8H2,1H3,(H,23,26) |
| InChIKey | WZNUEEUUGGDUNY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|