C14H16Cl2F3N5O — CID 19325915
4-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-ethylpyrazole-3-carboxamide (PubChem CID 19325915) has the molecular formula C14H16Cl2F3N5O and a molecular weight of 398.22 g/mol. Its IUPAC name is 4-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19325915 |
| Molecular Formula | C14H16Cl2F3N5O |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-chloro-N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(Cl)c(C(=O)NCCCn2nc(C(F)(F)F)c(Cl)c2C)n1 |
| InChI | InChI=1S/C14H16Cl2F3N5O/c1-3-23-7-9(15)11(21-23)13(25)20-5-4-6-24-8(2)10(16)12(22-24)14(17,18)19/h7H,3-6H2,1-2H3,(H,20,25) |
| InChIKey | DYDHXWLJGKHENC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|