C13H17Cl2N3O4 — CID 122006806
3-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122006806) has the molecular formula C13H17Cl2N3O4 and a molecular weight of 350.20 g/mol. Its IUPAC name is 3-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122006806 |
| Molecular Formula | C13H17Cl2N3O4 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)NCCOc1ncc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H17Cl2N3O4/c1-8(12(19)20)7-18(2)13(21)16-3-4-22-11-10(15)5-9(14)6-17-11/h5-6,8H,3-4,7H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | STUQWWSJBYYPFG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|