C16H24N2O6 — CID 122006874
3-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122006874) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122006874 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenoxy)ethylcarbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | COc1cc(OC)cc(OCCNC(=O)N(C)CC(C)C(=O)O)c1 |
| InChI | InChI=1S/C16H24N2O6/c1-11(15(19)20)10-18(2)16(21)17-5-6-24-14-8-12(22-3)7-13(9-14)23-4/h7-9,11H,5-6,10H2,1-4H3,(H,17,21)(H,19,20) |
| InChIKey | MXYVPHKYLYEFGP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|