C14H18F3N3O4 — CID 122007379
2-methyl-3-[methyl-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]amino]propanoic acid (PubChem CID 122007379) has the molecular formula C14H18F3N3O4 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122007379 |
| Molecular Formula | C14H18F3N3O4 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-methyl-3-[methyl-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)NCCOc1ncccc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H18F3N3O4/c1-9(12(21)22)8-20(2)13(23)19-6-7-24-11-10(14(15,16)17)4-3-5-18-11/h3-5,9H,6-8H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | GZBXRMUOKFRBRB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|