C16H15F3N2O3 — CID 122032156
4-[[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]methyl]benzoic acid (PubChem CID 122032156) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is 4-[[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122032156 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-[[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCOc2ncccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N2O3/c17-16(18,19)13-2-1-7-21-14(13)24-9-8-20-10-11-3-5-12(6-4-11)15(22)23/h1-7,20H,8-10H2,(H,22,23) |
| InChIKey | HPAVGOQLZVULOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|