C13H13F3N2O4 — CID 120697842
2-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 120697842) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 120697842 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1C(=O)NCCOc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O4/c14-13(15,16)9-2-1-3-18-11(9)22-5-4-17-10(19)7-6-8(7)12(20)21/h1-3,7-8H,4-6H2,(H,17,19)(H,20,21) |
| InChIKey | BICLKQFOICDOFD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|