C15H16F3NO3 — CID 120975402
2-[2-[2-(trifluoromethyl)phenyl]ethylcarbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 120975402) has the molecular formula C15H16F3NO3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[2-[2-(trifluoromethyl)phenyl]ethylcarbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[2-[2-(trifluoromethyl)phenyl]ethylcarbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120975402 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2-[2-(trifluoromethyl)phenyl]ethylcarbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1C(=O)NCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO3/c16-15(17,18)12-4-2-1-3-9(12)7-8-19-13(20)10-5-6-11(10)14(21)22/h1-4,10-11H,5-8H2,(H,19,20)(H,21,22) |
| InChIKey | XPZANUQVGKHQPE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |