C15H18Cl2N2O3 — CID 167928916
3-(2,4-dichlorophenoxy)-N-[[(2R)-6-oxopiperidin-2-yl]methyl]propanamide (PubChem CID 167928916) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-N-[[(2R)-6-oxopiperidin-2-yl]methyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenoxy)-N-[[(2R)-6-oxopiperidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 167928916 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-N-[[(2R)-6-oxopiperidin-2-yl]methyl]propanamide |
| SMILES | O=C(CCOc1ccc(Cl)cc1Cl)NC[C@H]1CCCC(=O)N1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c16-10-4-5-13(12(17)8-10)22-7-6-14(20)18-9-11-2-1-3-15(21)19-11/h4-5,8,11H,1-3,6-7,9H2,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | TVGLXHOJFPZGOT-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |