C20H17Cl4N3O3 — CID 139551537
(2S)-1-N,2-N-bis[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxamide (PubChem CID 139551537) has the molecular formula C20H17Cl4N3O3 and a molecular weight of 489.19 g/mol. Its IUPAC name is (2S)-1-N,2-N-bis[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N,2-N-bis[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139551537 |
| Molecular Formula | C20H17Cl4N3O3 |
| Molecular Weight | 489.19 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | (2S)-1-N,2-N-bis[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)[C@@H]1CCC(=O)N1C(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl4N3O3/c21-13-3-1-11(15(23)7-13)9-25-19(29)17-5-6-18(28)27(17)20(30)26-10-12-2-4-14(22)8-16(12)24/h1-4,7-8,17H,5-6,9-10H2,(H,25,29)(H,26,30)/t17-/m0/s1 |
| InChIKey | OHCHXCOEPPAEGT-KRWDZBQOSA-N |
| XLogP | 4.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |