C24H27Cl2N3O3 — CID 139551721
(2S)-2-N-[(2,4-dichlorophenyl)methyl]-1-N-(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)-5-oxopyrrolidine-1,2-dicarboxamide (PubChem CID 139551721) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is (2S)-2-N-[(2,4-dichlorophenyl)methyl]-1-N-(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)-5-oxopyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-[(2,4-dichlorophenyl)methyl]-1-N-(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)-5-oxopyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139551721 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2S)-2-N-[(2,4-dichlorophenyl)methyl]-1-N-(5-methyl-5-tricyclo[5.2.1.03,9]dec-3-enyl)-5-oxopyrrolidine-1,2-dicarboxamide |
| SMILES | CC1(NC(=O)N2C(=O)CC[C@H]2C(=O)NCc2ccc(Cl)cc2Cl)C=C2CC3CC(CC23)C1 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-24(10-13-6-15-8-16(11-24)18(15)7-13)28-23(32)29-20(4-5-21(29)30)22(31)27-12-14-2-3-17(25)9-19(14)26/h2-3,9,11,13,15,18,20H,4-8,10,12H2,1H3,(H,27,31)(H,28,32)/t13?,15?,18?,20-,24?/m0/s1 |
| InChIKey | NNMXNBPKIFQKEY-BHRDOHCXSA-N |
| XLogP | 4.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|