C15H18Cl2N2O2 — CID 25015842
N-[(2,5-dichlorophenyl)methyl]-1-ethyl-6-oxopiperidine-2-carboxamide (PubChem CID 25015842) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-1-ethyl-6-oxopiperidine-2-carboxamide.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-1-ethyl-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 25015842 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-1-ethyl-6-oxopiperidine-2-carboxamide |
| SMILES | CCN1C(=O)CCCC1C(=O)NCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-2-19-13(4-3-5-14(19)20)15(21)18-9-10-8-11(16)6-7-12(10)17/h6-8,13H,2-5,9H2,1H3,(H,18,21) |
| InChIKey | NHFNFOLYHPWTST-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |