C14H15ClF2N2O2 — CID 67462741
(2S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-1-ethyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 67462741) has the molecular formula C14H15ClF2N2O2 and a molecular weight of 316.74 g/mol. Its IUPAC name is (2S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-1-ethyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-1-ethyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67462741 |
| Molecular Formula | C14H15ClF2N2O2 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-1-ethyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CCN1C(=O)CC[C@H]1C(=O)NCc1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C14H15ClF2N2O2/c1-2-19-10(5-6-11(19)20)14(21)18-7-8-3-4-9(16)13(17)12(8)15/h3-4,10H,2,5-7H2,1H3,(H,18,21)/t10-/m0/s1 |
| InChIKey | WUEFEDIBGNIFJK-JTQLQIEISA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|