C12H12ClF2N3O2 — CID 71452624
(4S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide (PubChem CID 71452624) has the molecular formula C12H12ClF2N3O2 and a molecular weight of 303.70 g/mol. Its IUPAC name is (4S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 71452624 |
| Molecular Formula | C12H12ClF2N3O2 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (4S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-3-methyl-2-oxoimidazolidine-4-carboxamide |
| SMILES | CN1C(=O)NC[C@H]1C(=O)NCc1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C12H12ClF2N3O2/c1-18-8(5-17-12(18)20)11(19)16-4-6-2-3-7(14)10(15)9(6)13/h2-3,8H,4-5H2,1H3,(H,16,19)(H,17,20)/t8-/m0/s1 |
| InChIKey | TZNQBXMMPSETQC-QMMMGPOBSA-N |
| XLogP | 1.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|