C14H17F3N2O3S — CID 42641366
1,1-dioxo-2-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]-1,2-thiazolidine-3-carboxamide (PubChem CID 42641366) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 1,1-dioxo-2-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]-1,2-thiazolidine-3-carboxamide.
| Compound Name | 1,1-dioxo-2-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 42641366 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1,1-dioxo-2-propan-2-yl-N-[(2,3,4-trifluorophenyl)methyl]-1,2-thiazolidine-3-carboxamide |
| SMILES | CC(C)N1C(C(=O)NCc2ccc(F)c(F)c2F)CCS1(=O)=O |
| InChI | InChI=1S/C14H17F3N2O3S/c1-8(2)19-11(5-6-23(19,21)22)14(20)18-7-9-3-4-10(15)13(17)12(9)16/h3-4,8,11H,5-7H2,1-2H3,(H,18,20) |
| InChIKey | KULSQNJVKJMJRE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|