C13H15ClF2N2O3S — CID 71459863
(3S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-2-ethyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide (PubChem CID 71459863) has the molecular formula C13H15ClF2N2O3S and a molecular weight of 352.79 g/mol. Its IUPAC name is (3S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-2-ethyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide.
| Compound Name | (3S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-2-ethyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 71459863 |
| Molecular Formula | C13H15ClF2N2O3S |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (3S)-N-[(2-chloro-3,4-difluorophenyl)methyl]-2-ethyl-1,1-dioxo-1,2-thiazolidine-3-carboxamide |
| SMILES | CCN1[C@H](C(=O)NCc2ccc(F)c(F)c2Cl)CCS1(=O)=O |
| InChI | InChI=1S/C13H15ClF2N2O3S/c1-2-18-10(5-6-22(18,20)21)13(19)17-7-8-3-4-9(15)12(16)11(8)14/h3-4,10H,2,5-7H2,1H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | KWVFJONDYGDGCO-JTQLQIEISA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|