C20H20Cl2N2O2 — CID 25015841
1-benzyl-N-[(2,5-dichlorophenyl)methyl]-6-oxopiperidine-2-carboxamide (PubChem CID 25015841) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-benzyl-N-[(2,5-dichlorophenyl)methyl]-6-oxopiperidine-2-carboxamide.
| Compound Name | 1-benzyl-N-[(2,5-dichlorophenyl)methyl]-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 25015841 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-benzyl-N-[(2,5-dichlorophenyl)methyl]-6-oxopiperidine-2-carboxamide |
| SMILES | O=C(NCc1cc(Cl)ccc1Cl)C1CCCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-16-9-10-17(22)15(11-16)12-23-20(26)18-7-4-8-19(25)24(18)13-14-5-2-1-3-6-14/h1-3,5-6,9-11,18H,4,7-8,12-13H2,(H,23,26) |
| InChIKey | WTBGYWZFUQEKPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |