C23H25N3O4 — CID 66644739
N-[(2R)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-benzyl-6-oxopiperidine-2-carboxamide (PubChem CID 66644739) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[(2R)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-benzyl-6-oxopiperidine-2-carboxamide.
| Compound Name | N-[(2R)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-benzyl-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 66644739 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[(2R)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-benzyl-6-oxopiperidine-2-carboxamide |
| SMILES | NC(=O)C(=O)[C@@H](Cc1ccccc1)NC(=O)C1CCCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c24-22(29)21(28)18(14-16-8-3-1-4-9-16)25-23(30)19-12-7-13-20(27)26(19)15-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2,(H2,24,29)(H,25,30)/t18-,19?/m1/s1 |
| InChIKey | ABLVWTPXLXMUKK-MRTLOADZSA-N |
| XLogP | 1.35 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|