C27H31N3O5 — CID 67095225
(2S)-1-benzyl-N-[4-[methyl(oxolan-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 67095225) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is (2S)-1-benzyl-N-[4-[methyl(oxolan-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-benzyl-N-[4-[methyl(oxolan-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67095225 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (2S)-1-benzyl-N-[4-[methyl(oxolan-2-yl)amino]-3,4-dioxo-1-phenylbutan-2-yl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN(C(=O)C(=O)C(Cc1ccccc1)NC(=O)[C@@H]1CCC(=O)N1Cc1ccccc1)C1CCCO1 |
| InChI | InChI=1S/C27H31N3O5/c1-29(24-13-8-16-35-24)27(34)25(32)21(17-19-9-4-2-5-10-19)28-26(33)22-14-15-23(31)30(22)18-20-11-6-3-7-12-20/h2-7,9-12,21-22,24H,8,13-18H2,1H3,(H,28,33)/t21?,22-,24?/m0/s1 |
| InChIKey | KCZLKVLOPFWIDC-MHIUNMELSA-N |
| XLogP | 2.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|