C24H27N3O6 — CID 66645053
(2S)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 66645053) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is (2S)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66645053 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2S)-N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | COc1cc(CN2C(=O)CC[C@H]2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)cc(OC)c1 |
| InChI | InChI=1S/C24H27N3O6/c1-32-17-10-16(11-18(13-17)33-2)14-27-20(8-9-21(27)28)24(31)26-19(22(29)23(25)30)12-15-6-4-3-5-7-15/h3-7,10-11,13,19-20H,8-9,12,14H2,1-2H3,(H2,25,30)(H,26,31)/t19?,20-/m0/s1 |
| InChIKey | NUXJKNJOOMVHOZ-ANYOKISRSA-N |
| XLogP | 0.98 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|