C16H15Cl2N3O3 — CID 155807315
methyl (2Z)-2-cyano-2-[5-[(2,4-dichlorophenyl)methylcarbamoyl]pyrrolidin-2-ylidene]acetate (PubChem CID 155807315) has the molecular formula C16H15Cl2N3O3 and a molecular weight of 368.22 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-[5-[(2,4-dichlorophenyl)methylcarbamoyl]pyrrolidin-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-cyano-2-[5-[(2,4-dichlorophenyl)methylcarbamoyl]pyrrolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 155807315 |
| Molecular Formula | C16H15Cl2N3O3 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | methyl (2Z)-2-cyano-2-[5-[(2,4-dichlorophenyl)methylcarbamoyl]pyrrolidin-2-ylidene]acetate |
| SMILES | COC(=O)/C(C#N)=C1/CCC(C(=O)NCc2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C16H15Cl2N3O3/c1-24-16(23)11(7-19)13-4-5-14(21-13)15(22)20-8-9-2-3-10(17)6-12(9)18/h2-3,6,14,21H,4-5,8H2,1H3,(H,20,22)/b13-11- |
| InChIKey | CBYIUFUPHOWNDX-QBFSEMIESA-N |
| XLogP | 2.31 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|