C12H10Cl2N2O4 — CID 107048504
3,6-dichloro-2-[(5-oxopyrrolidine-2-carbonyl)amino]benzoic acid (PubChem CID 107048504) has the molecular formula C12H10Cl2N2O4 and a molecular weight of 317.13 g/mol. Its IUPAC name is 3,6-dichloro-2-[(5-oxopyrrolidine-2-carbonyl)amino]benzoic acid.
| Compound Name | 3,6-dichloro-2-[(5-oxopyrrolidine-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107048504 |
| Molecular Formula | C12H10Cl2N2O4 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3,6-dichloro-2-[(5-oxopyrrolidine-2-carbonyl)amino]benzoic acid |
| SMILES | O=C1CCC(C(=O)Nc2c(Cl)ccc(Cl)c2C(=O)O)N1 |
| InChI | InChI=1S/C12H10Cl2N2O4/c13-5-1-2-6(14)10(9(5)12(19)20)16-11(18)7-3-4-8(17)15-7/h1-2,7H,3-4H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | NVFAOEWOAYNLMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |