C13H13Cl2NO4 — CID 107048594
3,6-dichloro-2-(oxane-4-carbonylamino)benzoic acid (PubChem CID 107048594) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is 3,6-dichloro-2-(oxane-4-carbonylamino)benzoic acid.
| Compound Name | 3,6-dichloro-2-(oxane-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 107048594 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 3,6-dichloro-2-(oxane-4-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1NC(=O)C1CCOCC1 |
| InChI | InChI=1S/C13H13Cl2NO4/c14-8-1-2-9(15)11(10(8)13(18)19)16-12(17)7-3-5-20-6-4-7/h1-2,7H,3-6H2,(H,16,17)(H,18,19) |
| InChIKey | VBFDEERJAFBJDX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |