C14H18N2O5 — CID 110689736
5-oxo-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 110689736) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-oxo-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110689736 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-oxo-N-(3,4,5-trimethoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCC(=O)N2)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N2O5/c1-19-10-6-8(7-11(20-2)13(10)21-3)15-14(18)9-4-5-12(17)16-9/h6-7,9H,4-5H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | IKBKLWRKHLQIIC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |