C12H11Cl2FN2O2 — CID 146122047
(2R)-N-(3,5-dichloro-4-fluorophenyl)-6-oxopiperidine-2-carboxamide (PubChem CID 146122047) has the molecular formula C12H11Cl2FN2O2 and a molecular weight of 305.14 g/mol. Its IUPAC name is (2R)-N-(3,5-dichloro-4-fluorophenyl)-6-oxopiperidine-2-carboxamide.
| Compound Name | (2R)-N-(3,5-dichloro-4-fluorophenyl)-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 146122047 |
| Molecular Formula | C12H11Cl2FN2O2 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (2R)-N-(3,5-dichloro-4-fluorophenyl)-6-oxopiperidine-2-carboxamide |
| SMILES | O=C1CCC[C@H](C(=O)Nc2cc(Cl)c(F)c(Cl)c2)N1 |
| InChI | InChI=1S/C12H11Cl2FN2O2/c13-7-4-6(5-8(14)11(7)15)16-12(19)9-2-1-3-10(18)17-9/h4-5,9H,1-3H2,(H,16,19)(H,17,18)/t9-/m1/s1 |
| InChIKey | MRFIWRDVEFAJGL-SECBINFHSA-N |
| XLogP | 2.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|