C15H20N2O2 — CID 78981915
N-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 78981915) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78981915 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C15H20N2O2/c1-3-10-6-5-7-11(4-2)14(10)17-15(19)12-8-13(18)16-9-12/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ZBFGRIJRBPRESH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |