C16H24N4O4S — CID 119864415
4-hydroxy-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolidine-2-carboxamide (PubChem CID 119864415) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-hydroxy-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119864415 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-hydroxy-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolidine-2-carboxamide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(NC(=O)C3CC(O)CN3)c2)CC1 |
| InChI | InChI=1S/C16H24N4O4S/c1-19-5-7-20(8-6-19)25(23,24)14-4-2-3-12(9-14)18-16(22)15-10-13(21)11-17-15/h2-4,9,13,15,17,21H,5-8,10-11H2,1H3,(H,18,22) |
| InChIKey | XQAMIBNGSMTRQY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |