C14H13ClN2O3S — CID 62915775
N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 62915775) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 62915775 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | N-[2-chloro-5-(4-hydroxybut-1-ynyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2cc(C#CCCO)ccc2Cl)CS1 |
| InChI | InChI=1S/C14H13ClN2O3S/c15-10-5-4-9(3-1-2-6-18)7-11(10)16-13(19)12-8-21-14(20)17-12/h4-5,7,12,18H,2,6,8H2,(H,16,19)(H,17,20) |
| InChIKey | MQLNRMAZMQQAJM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|