C13H18N2O4S — CID 63900518
ethyl 2-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfamoyl)acetate (PubChem CID 63900518) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is ethyl 2-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfamoyl)acetate.
| Compound Name | ethyl 2-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfamoyl)acetate |
|---|---|
| PubChem CID | 63900518 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 2-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfamoyl)acetate |
| SMILES | CCOC(=O)CS(=O)(=O)Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C13H18N2O4S/c1-2-19-13(16)9-20(17,18)15-12-4-3-10-5-6-14-8-11(10)7-12/h3-4,7,14-15H,2,5-6,8-9H2,1H3 |
| InChIKey | IILVPGNPYWVRLP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |