C19H23N3 — CID 167250548
6-(4-phenylpiperazin-2-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 167250548) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 6-(4-phenylpiperazin-2-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(4-phenylpiperazin-2-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 167250548 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 6-(4-phenylpiperazin-2-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(N2CCNC(c3ccc4c(c3)CCCN4)C2)cc1 |
| InChI | InChI=1S/C19H23N3/c1-2-6-17(7-3-1)22-12-11-21-19(14-22)16-8-9-18-15(13-16)5-4-10-20-18/h1-3,6-9,13,19-21H,4-5,10-12,14H2 |
| InChIKey | DCYJRLYRNGKZNI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |