C14H20N2 — CID 83392528
6-piperidin-3-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 83392528) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 6-piperidin-3-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-piperidin-3-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 83392528 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 6-piperidin-3-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1C1CCCNC1)CCCN2 |
| InChI | InChI=1S/C14H20N2/c1-4-13(10-15-7-1)11-5-6-14-12(9-11)3-2-8-16-14/h5-6,9,13,15-16H,1-4,7-8,10H2 |
| InChIKey | LLMMXVMDOFPPOA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |