C12H16N2 — CID 55272647
(R)-cyclopropyl(2,3-dihydro-1H-indol-5-yl)methanamine (PubChem CID 55272647) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (R)-cyclopropyl(2,3-dihydro-1H-indol-5-yl)methanamine.
| Compound Name | (R)-cyclopropyl(2,3-dihydro-1H-indol-5-yl)methanamine |
|---|---|
| PubChem CID | 55272647 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (R)-cyclopropyl(2,3-dihydro-1H-indol-5-yl)methanamine |
| SMILES | N[C@@H](c1ccc2c(c1)CCN2)C1CC1 |
| InChI | InChI=1S/C12H16N2/c13-12(8-1-2-8)10-3-4-11-9(7-10)5-6-14-11/h3-4,7-8,12,14H,1-2,5-6,13H2/t12-/m1/s1 |
| InChIKey | FSIPSCHXEFLMQG-GFCCVEGCSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |