C17H18ClN — CID 171213662
(R)-cyclopropyl(9H-fluoren-2-yl)methanamine;hydrochloride (PubChem CID 171213662) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is (R)-cyclopropyl(9H-fluoren-2-yl)methanamine;hydrochloride.
| Compound Name | (R)-cyclopropyl(9H-fluoren-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171213662 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (R)-cyclopropyl(9H-fluoren-2-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc2c(c1)Cc1ccccc1-2)C1CC1 |
| InChI | InChI=1S/C17H17N.ClH/c18-17(11-5-6-11)13-7-8-16-14(10-13)9-12-3-1-2-4-15(12)16;/h1-4,7-8,10-11,17H,5-6,9,18H2;1H/t17-;/m1./s1 |
| InChIKey | LHTITFTVMQJXBB-UNTBIKODSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |