C17H17ClF3N — CID 171233279
(1S)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutan-1-amine;hydrochloride (PubChem CID 171233279) has the molecular formula C17H17ClF3N and a molecular weight of 327.78 g/mol. Its IUPAC name is (1S)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171233279 |
| Molecular Formula | C17H17ClF3N |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (1S)-1-(9H-fluoren-2-yl)-4,4,4-trifluorobutan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCC(F)(F)F)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H16F3N.ClH/c18-17(19,20)8-7-16(21)12-5-6-15-13(10-12)9-11-3-1-2-4-14(11)15;/h1-6,10,16H,7-9,21H2;1H/t16-;/m0./s1 |
| InChIKey | GWCUJAPFTBOOQM-NTISSMGPSA-N |
| XLogP | 5.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |