C17H21ClN2 — CID 171233257
(1S)-1-(9H-fluoren-2-yl)butane-1,4-diamine;hydrochloride (PubChem CID 171233257) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is (1S)-1-(9H-fluoren-2-yl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(9H-fluoren-2-yl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171233257 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1S)-1-(9H-fluoren-2-yl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H20N2.ClH/c18-9-3-6-17(19)13-7-8-16-14(11-13)10-12-4-1-2-5-15(12)16;/h1-2,4-5,7-8,11,17H,3,6,9-10,18-19H2;1H/t17-;/m0./s1 |
| InChIKey | DTYGHAQRRJEULY-LMOVPXPDSA-N |
| XLogP | 3.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |