C16H17NO2 — CID 170829007
3-amino-1-(9H-fluoren-2-yl)propane-1,2-diol (PubChem CID 170829007) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-amino-1-(9H-fluoren-2-yl)propane-1,2-diol.
| Compound Name | 3-amino-1-(9H-fluoren-2-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170829007 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-amino-1-(9H-fluoren-2-yl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H17NO2/c17-9-15(18)16(19)11-5-6-14-12(8-11)7-10-3-1-2-4-13(10)14/h1-6,8,15-16,18-19H,7,9,17H2 |
| InChIKey | RUHJGASOYZLJGP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |