C19H24ClNO — CID 171265069
(1R,2S)-1-amino-1-(9H-fluoren-2-yl)-3,3-dimethylbutan-2-ol;hydrochloride (PubChem CID 171265069) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(9H-fluoren-2-yl)-3,3-dimethylbutan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(9H-fluoren-2-yl)-3,3-dimethylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171265069 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (1R,2S)-1-amino-1-(9H-fluoren-2-yl)-3,3-dimethylbutan-2-ol;hydrochloride |
| SMILES | CC(C)(C)[C@H](O)[C@H](N)c1ccc2c(c1)Cc1ccccc1-2.Cl |
| InChI | InChI=1S/C19H23NO.ClH/c1-19(2,3)18(21)17(20)13-8-9-16-14(11-13)10-12-6-4-5-7-15(12)16;/h4-9,11,17-18,21H,10,20H2,1-3H3;1H/t17-,18-;/m1./s1 |
| InChIKey | AFAPWZXLRBTXII-JAXOOIEVSA-N |
| XLogP | 4.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |